C22H19N3O3S — CID 144951533
ethane;2-[[5-[5-(2-naphthalen-2-ylethynyl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 144951533) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is ethane;2-[[5-[5-(2-naphthalen-2-ylethynyl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | ethane;2-[[5-[5-(2-naphthalen-2-ylethynyl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 144951533 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | ethane;2-[[5-[5-(2-naphthalen-2-ylethynyl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | CC.O=C(O)CSc1n[nH]c(-c2ccc(C#Cc3ccc4ccccc4c3)o2)n1 |
| InChI | InChI=1S/C20H13N3O3S.C2H6/c24-18(25)12-27-20-21-19(22-23-20)17-10-9-16(26-17)8-6-13-5-7-14-3-1-2-4-15(14)11-13;1-2/h1-5,7,9-11H,12H2,(H,24,25)(H,21,22,23);1-2H3 |
| InChIKey | JKUBOGWREGCSRG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|