C22H17NO3S — CID 123708724
2-[C-methyl-N-[1-[5-(2-naphthalen-2-ylethynyl)furan-2-yl]ethenyl]carbonimidoyl]sulfanylacetic acid (PubChem CID 123708724) has the molecular formula C22H17NO3S and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-[C-methyl-N-[1-[5-(2-naphthalen-2-ylethynyl)furan-2-yl]ethenyl]carbonimidoyl]sulfanylacetic acid.
| Compound Name | 2-[C-methyl-N-[1-[5-(2-naphthalen-2-ylethynyl)furan-2-yl]ethenyl]carbonimidoyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 123708724 |
| Molecular Formula | C22H17NO3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-[C-methyl-N-[1-[5-(2-naphthalen-2-ylethynyl)furan-2-yl]ethenyl]carbonimidoyl]sulfanylacetic acid |
| SMILES | C=C(/N=C(\C)SCC(=O)O)c1ccc(C#Cc2ccc3ccccc3c2)o1 |
| InChI | InChI=1S/C22H17NO3S/c1-15(23-16(2)27-14-22(24)25)21-12-11-20(26-21)10-8-17-7-9-18-5-3-4-6-19(18)13-17/h3-7,9,11-13H,1,14H2,2H3,(H,24,25)/b23-16+ |
| InChIKey | GLCZKCULQVUDIQ-XQNSMLJCSA-N |
| XLogP | 5.04 |
| TPSA | 62.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|