C27H26O2 — CID 123619016
1-[1,1,3,3-tetramethyl-6-(2-naphthalen-2-ylethynyl)-2-benzofuran-5-yl]propan-1-one (PubChem CID 123619016) has the molecular formula C27H26O2 and a molecular weight of 382.50 g/mol. Its IUPAC name is 1-[1,1,3,3-tetramethyl-6-(2-naphthalen-2-ylethynyl)-2-benzofuran-5-yl]propan-1-one.
| Compound Name | 1-[1,1,3,3-tetramethyl-6-(2-naphthalen-2-ylethynyl)-2-benzofuran-5-yl]propan-1-one |
|---|---|
| PubChem CID | 123619016 |
| Molecular Formula | C27H26O2 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1-[1,1,3,3-tetramethyl-6-(2-naphthalen-2-ylethynyl)-2-benzofuran-5-yl]propan-1-one |
| SMILES | CCC(=O)c1cc2c(cc1C#Cc1ccc3ccccc3c1)C(C)(C)OC2(C)C |
| InChI | InChI=1S/C27H26O2/c1-6-25(28)22-17-24-23(26(2,3)29-27(24,4)5)16-21(22)14-12-18-11-13-19-9-7-8-10-20(19)15-18/h7-11,13,15-17H,6H2,1-5H3 |
| InChIKey | HUPBAFLRQIOMFK-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|