C24H14O4 — CID 139949288
2-(2-naphthalen-2-ylethynyl)naphthalene-1,5-dicarboxylic acid (PubChem CID 139949288) has the molecular formula C24H14O4 and a molecular weight of 366.37 g/mol. Its IUPAC name is 2-(2-naphthalen-2-ylethynyl)naphthalene-1,5-dicarboxylic acid.
| Compound Name | 2-(2-naphthalen-2-ylethynyl)naphthalene-1,5-dicarboxylic acid |
|---|---|
| PubChem CID | 139949288 |
| Molecular Formula | C24H14O4 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-(2-naphthalen-2-ylethynyl)naphthalene-1,5-dicarboxylic acid |
| SMILES | O=C(O)c1cccc2c(C(=O)O)c(C#Cc3ccc4ccccc4c3)ccc12 |
| InChI | InChI=1S/C24H14O4/c25-23(26)21-7-3-6-20-19(21)13-12-17(22(20)24(27)28)11-9-15-8-10-16-4-1-2-5-18(16)14-15/h1-8,10,12-14H,(H,25,26)(H,27,28) |
| InChIKey | SQISQGYCARQMAW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|