C41H28O4 — CID 139949322
3-[2-[3-carboxy-2-(2-naphthalen-2-ylethynyl)phenyl]propan-2-yl]-2-(2-naphthalen-2-ylethynyl)benzoic acid (PubChem CID 139949322) has the molecular formula C41H28O4 and a molecular weight of 584.67 g/mol. Its IUPAC name is 3-[2-[3-carboxy-2-(2-naphthalen-2-ylethynyl)phenyl]propan-2-yl]-2-(2-naphthalen-2-ylethynyl)benzoic acid.
| Compound Name | 3-[2-[3-carboxy-2-(2-naphthalen-2-ylethynyl)phenyl]propan-2-yl]-2-(2-naphthalen-2-ylethynyl)benzoic acid |
|---|---|
| PubChem CID | 139949322 |
| Molecular Formula | C41H28O4 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | 3-[2-[3-carboxy-2-(2-naphthalen-2-ylethynyl)phenyl]propan-2-yl]-2-(2-naphthalen-2-ylethynyl)benzoic acid |
| SMILES | CC(C)(c1cccc(C(=O)O)c1C#Cc1ccc2ccccc2c1)c1cccc(C(=O)O)c1C#Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C41H28O4/c1-41(2,37-15-7-13-35(39(42)43)33(37)23-19-27-17-21-29-9-3-5-11-31(29)25-27)38-16-8-14-36(40(44)45)34(38)24-20-28-18-22-30-10-4-6-12-32(30)26-28/h3-18,21-22,25-26H,1-2H3,(H,42,43)(H,44,45) |
| InChIKey | QPDYYMPXZNGGMP-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|