C17H17N5O3S2 — CID 144951757
2-[[5-[3-(hydroxyamino)-5-[3-(methylaminosulfanyl)phenyl]phenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 144951757) has the molecular formula C17H17N5O3S2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 2-[[5-[3-(hydroxyamino)-5-[3-(methylaminosulfanyl)phenyl]phenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[3-(hydroxyamino)-5-[3-(methylaminosulfanyl)phenyl]phenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 144951757 |
| Molecular Formula | C17H17N5O3S2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 2-[[5-[3-(hydroxyamino)-5-[3-(methylaminosulfanyl)phenyl]phenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | CNSc1cccc(-c2cc(NO)cc(-c3nc(SCC(=O)O)n[nH]3)c2)c1 |
| InChI | InChI=1S/C17H17N5O3S2/c1-18-27-14-4-2-3-10(8-14)11-5-12(7-13(6-11)22-25)16-19-17(21-20-16)26-9-15(23)24/h2-8,18,22,25H,9H2,1H3,(H,23,24)(H,19,20,21) |
| InChIKey | QAJQHFRENCIMMM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|