C19H23N7S — CID 126612775
2-[amino-[7-(1,3-benzothiazol-2-yl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]amino]-N,N-dimethylethanamine (PubChem CID 126612775) has the molecular formula C19H23N7S and a molecular weight of 381.51 g/mol. Its IUPAC name is 2-[amino-[7-(1,3-benzothiazol-2-yl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]amino]-N,N-dimethylethanamine.
| Compound Name | 2-[amino-[7-(1,3-benzothiazol-2-yl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]amino]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 126612775 |
| Molecular Formula | C19H23N7S |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-[amino-[7-(1,3-benzothiazol-2-yl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]amino]-N,N-dimethylethanamine |
| SMILES | Cc1c(C)n(-c2nc3ccccc3s2)c2ncnc(N(N)CCN(C)C)c12 |
| InChI | InChI=1S/C19H23N7S/c1-12-13(2)26(19-23-14-7-5-6-8-15(14)27-19)18-16(12)17(21-11-22-18)25(20)10-9-24(3)4/h5-8,11H,9-10,20H2,1-4H3 |
| InChIKey | GOXKRDGAAWDQRW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|