About propan-2-yl 2-[5-bromo-4-(3,4-dihydro-2H-chromen-6-yl)-2-(hydroxymethyl)-6-methyl-3-pyridinyl]acetate
propan-2-yl 2-[5-bromo-4-(3,4-dihydro-2H-chromen-6-yl)-2-(hydroxymethyl)-6-methyl-3-pyridinyl]acetate (PubChem CID 126615577) has the molecular formula C21H24BrNO4
and a molecular weight of 434.33 g/mol. Its IUPAC name is propan-2-yl 2-[5-bromo-4-(3,4-dihydro-2H-chromen-6-yl)-2-(hydroxymethyl)-6-methyl-3-pyridinyl]acetate.
Molecular Properties
| Compound Name | propan-2-yl 2-[5-bromo-4-(3,4-dihydro-2H-chromen-6-yl)-2-(hydroxymethyl)-6-methyl-3-pyridinyl]acetate |
| PubChem CID | 126615577 |
| Molecular Formula | C21H24BrNO4 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | propan-2-yl 2-[5-bromo-4-(3,4-dihydro-2H-chromen-6-yl)-2-(hydroxymethyl)-6-methyl-3-pyridinyl]acetate |
| SMILES | Cc1nc(CO)c(CC(=O)OC(C)C)c(-c2ccc3c(c2)CCCO3)c1Br |
| InChI | InChI=1S/C21H24BrNO4/c1-12(2)27-19(25)10-16-17(11-24)23-13(3)21(22)20(16)15-6-7-18-14(9-15)5-4-8-26-18/h6-7,9,12,24H,4-5,8,10-11H2,1-3H3 |
| InChIKey | WHYLTPKWSBVRPU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propan-2-yl 2-[5-bromo-4-(3,4-dihydro-2H-chromen-6-yl)-2-(hydroxymethyl)-6-methyl-3-pyridinyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[5-bromo-4-(3,4-dihydro-2H-chromen-6-yl)-2-(hydroxymethyl)-6-methyl-3-pyridinyl]acetate?
The IUPAC name of propan-2-yl 2-[5-bromo-4-(3,4-dihydro-2H-chromen-6-yl)-2-(hydroxymethyl)-6-methyl-3-pyridinyl]acetate (CID 126615577) is propan-2-yl 2-[5-bromo-4-(3,4-dihydro-2H-chromen-6-yl)-2-(hydroxymethyl)-6-methyl-3-pyridinyl]acetate.
What is the SMILES notation for propan-2-yl 2-[5-bromo-4-(3,4-dihydro-2H-chromen-6-yl)-2-(hydroxymethyl)-6-methyl-3-pyridinyl]acetate?
The canonical SMILES for propan-2-yl 2-[5-bromo-4-(3,4-dihydro-2H-chromen-6-yl)-2-(hydroxymethyl)-6-methyl-3-pyridinyl]acetate is Cc1nc(CO)c(CC(=O)OC(C)C)c(-c2ccc3c(c2)CCCO3)c1Br.
What is the InChIKey of propan-2-yl 2-[5-bromo-4-(3,4-dihydro-2H-chromen-6-yl)-2-(hydroxymethyl)-6-methyl-3-pyridinyl]acetate?
The InChIKey is WHYLTPKWSBVRPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24BrNO4/c1-12(2)27-19(25)10-16-17(11-24)23-13(3)21(22)20(16)15-6-7-18-14(9-15)5-4-8-26-18/h6-7,9,12,24H,4-5,8,10-11H2,1-3H3.
What are the key properties of propan-2-yl 2-[5-bromo-4-(3,4-dihydro-2H-chromen-6-yl)-2-(hydroxymethyl)-6-methyl-3-pyridinyl]acetate?
propan-2-yl 2-[5-bromo-4-(3,4-dihydro-2H-chromen-6-yl)-2-(hydroxymethyl)-6-methyl-3-pyridinyl]acetate has a molecular weight of 434.33 g/mol, XLogP of 4.13, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[5-bromo-4-(3,4-dihydro-2H-chromen-6-yl)-2-(hydroxymethyl)-6-methyl-3-pyridinyl]acetate is sourced from PubChem (CID 126615577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).