C30H28ClF3N4O3S — CID 126616908
4-[(4-chlorophenyl)-[2-cyclopropyl-3-[1-(trifluoromethylsulfonyl)piperidin-4-yl]indazol-5-yl]methyl]benzamide (PubChem CID 126616908) has the molecular formula C30H28ClF3N4O3S and a molecular weight of 617.09 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)-[2-cyclopropyl-3-[1-(trifluoromethylsulfonyl)piperidin-4-yl]indazol-5-yl]methyl]benzamide.
| Compound Name | 4-[(4-chlorophenyl)-[2-cyclopropyl-3-[1-(trifluoromethylsulfonyl)piperidin-4-yl]indazol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 126616908 |
| Molecular Formula | C30H28ClF3N4O3S |
| Molecular Weight | 617.09 g/mol |
| Exact Mass | 616.15 |
| IUPAC Name | 4-[(4-chlorophenyl)-[2-cyclopropyl-3-[1-(trifluoromethylsulfonyl)piperidin-4-yl]indazol-5-yl]methyl]benzamide |
| SMILES | NC(=O)c1ccc(C(c2ccc(Cl)cc2)c2ccc3nn(C4CC4)c(C4CCN(S(=O)(=O)C(F)(F)F)CC4)c3c2)cc1 |
| InChI | InChI=1S/C30H28ClF3N4O3S/c31-23-8-5-19(6-9-23)27(18-1-3-21(4-2-18)29(35)39)22-7-12-26-25(17-22)28(38(36-26)24-10-11-24)20-13-15-37(16-14-20)42(40,41)30(32,33)34/h1-9,12,17,20,24,27H,10-11,13-16H2,(H2,35,39) |
| InChIKey | VRSZULDXEYTPSY-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.09 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|