C29H26Cl2F3N3O2S — CID 126616938
5-[bis(4-chlorophenyl)methyl]-2-cyclopropyl-3-[1-(trifluoromethylsulfonyl)piperidin-4-yl]indazole (PubChem CID 126616938) has the molecular formula C29H26Cl2F3N3O2S and a molecular weight of 608.51 g/mol. Its IUPAC name is 5-[bis(4-chlorophenyl)methyl]-2-cyclopropyl-3-[1-(trifluoromethylsulfonyl)piperidin-4-yl]indazole.
| Compound Name | 5-[bis(4-chlorophenyl)methyl]-2-cyclopropyl-3-[1-(trifluoromethylsulfonyl)piperidin-4-yl]indazole |
|---|---|
| PubChem CID | 126616938 |
| Molecular Formula | C29H26Cl2F3N3O2S |
| Molecular Weight | 608.51 g/mol |
| Exact Mass | 607.11 |
| IUPAC Name | 5-[bis(4-chlorophenyl)methyl]-2-cyclopropyl-3-[1-(trifluoromethylsulfonyl)piperidin-4-yl]indazole |
| SMILES | O=S(=O)(N1CCC(c2c3cc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)ccc3nn2C2CC2)CC1)C(F)(F)F |
| InChI | InChI=1S/C29H26Cl2F3N3O2S/c30-22-6-1-18(2-7-22)27(19-3-8-23(31)9-4-19)21-5-12-26-25(17-21)28(37(35-26)24-10-11-24)20-13-15-36(16-14-20)40(38,39)29(32,33)34/h1-9,12,17,20,24,27H,10-11,13-16H2 |
| InChIKey | FKHSAPZSWBUDHD-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.51 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|