C38H39N3O2 — CID 126617137
3-[[4-[5-[bis(4-methylphenyl)methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]methyl]benzoic acid (PubChem CID 126617137) has the molecular formula C38H39N3O2 and a molecular weight of 569.75 g/mol. Its IUPAC name is 3-[[4-[5-[bis(4-methylphenyl)methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[4-[5-[bis(4-methylphenyl)methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 126617137 |
| Molecular Formula | C38H39N3O2 |
| Molecular Weight | 569.75 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | 3-[[4-[5-[bis(4-methylphenyl)methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]methyl]benzoic acid |
| SMILES | Cc1ccc(C(c2ccc(C)cc2)c2ccc3c(c2)c(C2CCN(Cc4cccc(C(=O)O)c4)CC2)nn3C2CC2)cc1 |
| InChI | InChI=1S/C38H39N3O2/c1-25-6-10-28(11-7-25)36(29-12-8-26(2)9-13-29)31-14-17-35-34(23-31)37(39-41(35)33-15-16-33)30-18-20-40(21-19-30)24-27-4-3-5-32(22-27)38(42)43/h3-14,17,22-23,30,33,36H,15-16,18-21,24H2,1-2H3,(H,42,43) |
| InChIKey | LXTUMLGCOQXQOD-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.75 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|