About ethyl 2-[4-(8-tert-butylsulfanylquinolin-3-yl)-4-oxobutyl]-1,3-thiazole-4-carboxylate
ethyl 2-[4-(8-tert-butylsulfanylquinolin-3-yl)-4-oxobutyl]-1,3-thiazole-4-carboxylate (PubChem CID 126617862) has the molecular formula C23H26N2O3S2
and a molecular weight of 442.61 g/mol. Its IUPAC name is ethyl 2-[4-(8-tert-butylsulfanylquinolin-3-yl)-4-oxobutyl]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[4-(8-tert-butylsulfanylquinolin-3-yl)-4-oxobutyl]-1,3-thiazole-4-carboxylate |
| PubChem CID | 126617862 |
| Molecular Formula | C23H26N2O3S2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | ethyl 2-[4-(8-tert-butylsulfanylquinolin-3-yl)-4-oxobutyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(CCCC(=O)c2cnc3c(SC(C)(C)C)cccc3c2)n1 |
| InChI | InChI=1S/C23H26N2O3S2/c1-5-28-22(27)17-14-29-20(25-17)11-7-9-18(26)16-12-15-8-6-10-19(21(15)24-13-16)30-23(2,3)4/h6,8,10,12-14H,5,7,9,11H2,1-4H3 |
| InChIKey | ZYBADSWVNDFEHY-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-[4-(8-tert-butylsulfanylquinolin-3-yl)-4-oxobutyl]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4-(8-tert-butylsulfanylquinolin-3-yl)-4-oxobutyl]-1,3-thiazole-4-carboxylate?
The IUPAC name of ethyl 2-[4-(8-tert-butylsulfanylquinolin-3-yl)-4-oxobutyl]-1,3-thiazole-4-carboxylate (CID 126617862) is ethyl 2-[4-(8-tert-butylsulfanylquinolin-3-yl)-4-oxobutyl]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for ethyl 2-[4-(8-tert-butylsulfanylquinolin-3-yl)-4-oxobutyl]-1,3-thiazole-4-carboxylate?
The canonical SMILES for ethyl 2-[4-(8-tert-butylsulfanylquinolin-3-yl)-4-oxobutyl]-1,3-thiazole-4-carboxylate is CCOC(=O)c1csc(CCCC(=O)c2cnc3c(SC(C)(C)C)cccc3c2)n1.
What is the InChIKey of ethyl 2-[4-(8-tert-butylsulfanylquinolin-3-yl)-4-oxobutyl]-1,3-thiazole-4-carboxylate?
The InChIKey is ZYBADSWVNDFEHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O3S2/c1-5-28-22(27)17-14-29-20(25-17)11-7-9-18(26)16-12-15-8-6-10-19(21(15)24-13-16)30-23(2,3)4/h6,8,10,12-14H,5,7,9,11H2,1-4H3.
What are the key properties of ethyl 2-[4-(8-tert-butylsulfanylquinolin-3-yl)-4-oxobutyl]-1,3-thiazole-4-carboxylate?
ethyl 2-[4-(8-tert-butylsulfanylquinolin-3-yl)-4-oxobutyl]-1,3-thiazole-4-carboxylate has a molecular weight of 442.61 g/mol, XLogP of 5.96, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4-(8-tert-butylsulfanylquinolin-3-yl)-4-oxobutyl]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 126617862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).