C17H19ClFNO2S — CID 160884615
ethyl 2-[5-(3-chloro-2-fluorophenyl)pentyl]-1,3-thiazole-4-carboxylate (PubChem CID 160884615) has the molecular formula C17H19ClFNO2S and a molecular weight of 355.86 g/mol. Its IUPAC name is ethyl 2-[5-(3-chloro-2-fluorophenyl)pentyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[5-(3-chloro-2-fluorophenyl)pentyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 160884615 |
| Molecular Formula | C17H19ClFNO2S |
| Molecular Weight | 355.86 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | ethyl 2-[5-(3-chloro-2-fluorophenyl)pentyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(CCCCCc2cccc(Cl)c2F)n1 |
| InChI | InChI=1S/C17H19ClFNO2S/c1-2-22-17(21)14-11-23-15(20-14)10-5-3-4-7-12-8-6-9-13(18)16(12)19/h6,8-9,11H,2-5,7,10H2,1H3 |
| InChIKey | SNLZPECZUCFJED-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.86 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|