C18H19NO7 — CID 126618348
2-[5-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-3-acetylindol-1-yl]acetic acid (PubChem CID 126618348) has the molecular formula C18H19NO7 and a molecular weight of 361.35 g/mol. Its IUPAC name is 2-[5-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-3-acetylindol-1-yl]acetic acid.
| Compound Name | 2-[5-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-3-acetylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 126618348 |
| Molecular Formula | C18H19NO7 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-[5-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-3-acetylindol-1-yl]acetic acid |
| SMILES | CC(=O)c1cn(CC(=O)O)c2ccc(O[C@@H]3CO[C@H]4[C@@H]3OC[C@H]4O)cc12 |
| InChI | InChI=1S/C18H19NO7/c1-9(20)12-5-19(6-16(22)23)13-3-2-10(4-11(12)13)26-15-8-25-17-14(21)7-24-18(15)17/h2-5,14-15,17-18,21H,6-8H2,1H3,(H,22,23)/t14-,15-,17-,18-/m1/s1 |
| InChIKey | AGGFOTHWFDFSFQ-JOCBIADPSA-N |
| XLogP | 0.83 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |