C29H40IN5O6S — CID 126619801
[5-[4-[1-[[1-[2-(carboniodidoylamino)-3,3-dimethylbutanoyl]-4-hydroxypyrrolidine-2-carbonyl]amino]ethyl]phenyl]-1,3-thiazol-4-yl]methyl (2S)-2-amino-3-methylbutanoate (PubChem CID 126619801) has the molecular formula C29H40IN5O6S and a molecular weight of 713.64 g/mol. Its IUPAC name is [5-[4-[1-[[1-[2-(carboniodidoylamino)-3,3-dimethylbutanoyl]-4-hydroxypyrrolidine-2-carbonyl]amino]ethyl]phenyl]-1,3-thiazol-4-yl]methyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | [5-[4-[1-[[1-[2-(carboniodidoylamino)-3,3-dimethylbutanoyl]-4-hydroxypyrrolidine-2-carbonyl]amino]ethyl]phenyl]-1,3-thiazol-4-yl]methyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 126619801 |
| Molecular Formula | C29H40IN5O6S |
| Molecular Weight | 713.64 g/mol |
| Exact Mass | 713.17 |
| IUPAC Name | [5-[4-[1-[[1-[2-(carboniodidoylamino)-3,3-dimethylbutanoyl]-4-hydroxypyrrolidine-2-carbonyl]amino]ethyl]phenyl]-1,3-thiazol-4-yl]methyl (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(NC(=O)C1CC(O)CN1C(=O)C(NC(=O)I)C(C)(C)C)c1ccc(-c2scnc2COC(=O)[C@@H](N)C(C)C)cc1 |
| InChI | InChI=1S/C29H40IN5O6S/c1-15(2)22(31)27(39)41-13-20-23(42-14-32-20)18-9-7-17(8-10-18)16(3)33-25(37)21-11-19(36)12-35(21)26(38)24(29(4,5)6)34-28(30)40/h7-10,14-16,19,21-22,24,36H,11-13,31H2,1-6H3,(H,33,37)(H,34,40)/t16?,19?,21?,22-,24?/m0/s1 |
| InChIKey | IJQOAGQXOPRRNF-QZCNETIJSA-N |
| XLogP | 3.53 |
| TPSA | 163.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.64 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|