C18H19N3O — CID 126620624
N-(4-methoxyphenyl)-N,2,6-trimethylquinazolin-4-amine (PubChem CID 126620624) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N,2,6-trimethylquinazolin-4-amine.
| Compound Name | N-(4-methoxyphenyl)-N,2,6-trimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 126620624 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N-(4-methoxyphenyl)-N,2,6-trimethylquinazolin-4-amine |
| SMILES | COc1ccc(N(C)c2nc(C)nc3ccc(C)cc23)cc1 |
| InChI | InChI=1S/C18H19N3O/c1-12-5-10-17-16(11-12)18(20-13(2)19-17)21(3)14-6-8-15(22-4)9-7-14/h5-11H,1-4H3 |
| InChIKey | XDHCCEXXDXZYEL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |