C19H20N4O3 — CID 11508604
methyl N-[4-(4-methoxy-N-methylanilino)-2-methylquinazolin-6-yl]carbamate (PubChem CID 11508604) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is methyl N-[4-(4-methoxy-N-methylanilino)-2-methylquinazolin-6-yl]carbamate.
| Compound Name | methyl N-[4-(4-methoxy-N-methylanilino)-2-methylquinazolin-6-yl]carbamate |
|---|---|
| PubChem CID | 11508604 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | methyl N-[4-(4-methoxy-N-methylanilino)-2-methylquinazolin-6-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2nc(C)nc(N(C)c3ccc(OC)cc3)c2c1 |
| InChI | InChI=1S/C19H20N4O3/c1-12-20-17-10-5-13(22-19(24)26-4)11-16(17)18(21-12)23(2)14-6-8-15(25-3)9-7-14/h5-11H,1-4H3,(H,22,24) |
| InChIKey | QLMYXXBYSOWJQN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |