C24H21N3O5 — CID 89468188
methyl N-[3-(methoxycarbonylamino)-6-(4-methoxyphenyl)phenanthridin-8-yl]carbamate (PubChem CID 89468188) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is methyl N-[3-(methoxycarbonylamino)-6-(4-methoxyphenyl)phenanthridin-8-yl]carbamate.
| Compound Name | methyl N-[3-(methoxycarbonylamino)-6-(4-methoxyphenyl)phenanthridin-8-yl]carbamate |
|---|---|
| PubChem CID | 89468188 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | methyl N-[3-(methoxycarbonylamino)-6-(4-methoxyphenyl)phenanthridin-8-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)nc(-c1ccc(OC)cc1)c1cc(NC(=O)OC)ccc12 |
| InChI | InChI=1S/C24H21N3O5/c1-30-17-8-4-14(5-9-17)22-20-12-15(25-23(28)31-2)6-10-18(20)19-11-7-16(13-21(19)27-22)26-24(29)32-3/h4-13H,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | MFPOGTUHHQZGQI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|