C24H18BrF2N7O — CID 126622379
N-(2-bromo-4-pyridinyl)-2-[6-(difluoromethyl)-2-pyridinyl]-9-[(4-methoxyphenyl)methyl]purin-6-amine (PubChem CID 126622379) has the molecular formula C24H18BrF2N7O and a molecular weight of 538.36 g/mol. Its IUPAC name is N-(2-bromo-4-pyridinyl)-2-[6-(difluoromethyl)-2-pyridinyl]-9-[(4-methoxyphenyl)methyl]purin-6-amine.
| Compound Name | N-(2-bromo-4-pyridinyl)-2-[6-(difluoromethyl)-2-pyridinyl]-9-[(4-methoxyphenyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 126622379 |
| Molecular Formula | C24H18BrF2N7O |
| Molecular Weight | 538.36 g/mol |
| Exact Mass | 537.07 |
| IUPAC Name | N-(2-bromo-4-pyridinyl)-2-[6-(difluoromethyl)-2-pyridinyl]-9-[(4-methoxyphenyl)methyl]purin-6-amine |
| SMILES | COc1ccc(Cn2cnc3c(Nc4ccnc(Br)c4)nc(-c4cccc(C(F)F)n4)nc32)cc1 |
| InChI | InChI=1S/C24H18BrF2N7O/c1-35-16-7-5-14(6-8-16)12-34-13-29-20-23(30-15-9-10-28-19(25)11-15)32-22(33-24(20)34)18-4-2-3-17(31-18)21(26)27/h2-11,13,21H,12H2,1H3,(H,28,30,32,33) |
| InChIKey | MNFKHMQHQNKNIU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.36 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|