C13H29N — CID 126624378
N-tert-butyl-3,3-dimethyl-N-propylbutan-2-amine (PubChem CID 126624378) has the molecular formula C13H29N and a molecular weight of 199.38 g/mol. Its IUPAC name is N-tert-butyl-3,3-dimethyl-N-propylbutan-2-amine.
| Compound Name | N-tert-butyl-3,3-dimethyl-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 126624378 |
| Molecular Formula | C13H29N |
| Molecular Weight | 199.38 g/mol |
| Exact Mass | 199.23 |
| IUPAC Name | N-tert-butyl-3,3-dimethyl-N-propylbutan-2-amine |
| SMILES | CCCN(C(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H29N/c1-9-10-14(13(6,7)8)11(2)12(3,4)5/h11H,9-10H2,1-8H3 |
| InChIKey | LQJCMDRJKMQNTK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |