C27H49N3O7 — CID 126625211
N-[2-[2-[2-[2-[3-[4-[(E)-5-methyl-4-oxohex-2-enyl]piperazin-1-yl]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide (PubChem CID 126625211) has the molecular formula C27H49N3O7 and a molecular weight of 527.70 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[3-[4-[(E)-5-methyl-4-oxohex-2-enyl]piperazin-1-yl]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide.
| Compound Name | N-[2-[2-[2-[2-[3-[4-[(E)-5-methyl-4-oxohex-2-enyl]piperazin-1-yl]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 126625211 |
| Molecular Formula | C27H49N3O7 |
| Molecular Weight | 527.70 g/mol |
| Exact Mass | 527.36 |
| IUPAC Name | N-[2-[2-[2-[2-[3-[4-[(E)-5-methyl-4-oxohex-2-enyl]piperazin-1-yl]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
| SMILES | CCCCC(=O)NCCOCCOCCOCCOCCC(=O)N1CCN(C/C=C/C(=O)C(C)C)CC1 |
| InChI | InChI=1S/C27H49N3O7/c1-4-5-8-26(32)28-10-17-35-19-21-37-23-22-36-20-18-34-16-9-27(33)30-14-12-29(13-15-30)11-6-7-25(31)24(2)3/h6-7,24H,4-5,8-23H2,1-3H3,(H,28,32)/b7-6+ |
| InChIKey | PGJJLXIJFNQSOS-VOTSOKGWSA-N |
| XLogP | 1.67 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.70 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|