C30H32F2N4O6 — CID 126625221
5-(2,6-difluoro-3,5-dimethoxyphenyl)-7-methyl-8-[(Z)-2-(methylideneamino)-2-[3-(morpholin-4-ylmethyl)-5-nitrophenyl]ethenyl]-5-azaspiro[2.5]oct-7-en-4-one (PubChem CID 126625221) has the molecular formula C30H32F2N4O6 and a molecular weight of 582.60 g/mol. Its IUPAC name is 5-(2,6-difluoro-3,5-dimethoxyphenyl)-7-methyl-8-[(Z)-2-(methylideneamino)-2-[3-(morpholin-4-ylmethyl)-5-nitrophenyl]ethenyl]-5-azaspiro[2.5]oct-7-en-4-one.
| Compound Name | 5-(2,6-difluoro-3,5-dimethoxyphenyl)-7-methyl-8-[(Z)-2-(methylideneamino)-2-[3-(morpholin-4-ylmethyl)-5-nitrophenyl]ethenyl]-5-azaspiro[2.5]oct-7-en-4-one |
|---|---|
| PubChem CID | 126625221 |
| Molecular Formula | C30H32F2N4O6 |
| Molecular Weight | 582.60 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | 5-(2,6-difluoro-3,5-dimethoxyphenyl)-7-methyl-8-[(Z)-2-(methylideneamino)-2-[3-(morpholin-4-ylmethyl)-5-nitrophenyl]ethenyl]-5-azaspiro[2.5]oct-7-en-4-one |
| SMILES | C=N/C(=C\C1=C(C)CN(c2c(F)c(OC)cc(OC)c2F)C(=O)C12CC2)c1cc(CN2CCOCC2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H32F2N4O6/c1-18-16-35(28-26(31)24(40-3)15-25(41-4)27(28)32)29(37)30(5-6-30)22(18)14-23(33-2)20-11-19(12-21(13-20)36(38)39)17-34-7-9-42-10-8-34/h11-15H,2,5-10,16-17H2,1,3-4H3/b23-14- |
| InChIKey | YTMOHPFTXFOUMC-UCQKPKSFSA-N |
| XLogP | 4.91 |
| TPSA | 106.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|