C22H30N2O — CID 126626779
(3S)-3,7-bis(benzylamino)-3-methylheptan-2-one (PubChem CID 126626779) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is (3S)-3,7-bis(benzylamino)-3-methylheptan-2-one.
| Compound Name | (3S)-3,7-bis(benzylamino)-3-methylheptan-2-one |
|---|---|
| PubChem CID | 126626779 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | (3S)-3,7-bis(benzylamino)-3-methylheptan-2-one |
| SMILES | CC(=O)[C@](C)(CCCCNCc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C22H30N2O/c1-19(25)22(2,24-18-21-13-7-4-8-14-21)15-9-10-16-23-17-20-11-5-3-6-12-20/h3-8,11-14,23-24H,9-10,15-18H2,1-2H3/t22-/m0/s1 |
| InChIKey | HCZKSPLNHFOZPU-QFIPXVFZSA-N |
| XLogP | 4.08 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|