C31H21F9O2 — CID 126626790
4-(4-but-3-enylphenyl)-1-[4-[difluoro-[3-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenoxy]methyl]-3-fluorophenyl]-2-fluorobenzene (PubChem CID 126626790) has the molecular formula C31H21F9O2 and a molecular weight of 596.49 g/mol. Its IUPAC name is 4-(4-but-3-enylphenyl)-1-[4-[difluoro-[3-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenoxy]methyl]-3-fluorophenyl]-2-fluorobenzene.
| Compound Name | 4-(4-but-3-enylphenyl)-1-[4-[difluoro-[3-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenoxy]methyl]-3-fluorophenyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 126626790 |
| Molecular Formula | C31H21F9O2 |
| Molecular Weight | 596.49 g/mol |
| Exact Mass | 596.14 |
| IUPAC Name | 4-(4-but-3-enylphenyl)-1-[4-[difluoro-[3-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenoxy]methyl]-3-fluorophenyl]-2-fluorobenzene |
| SMILES | C=CCCc1ccc(-c2ccc(-c3ccc(C(F)(F)Oc4ccc(OC(F)(F)C(F)F)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C31H21F9O2/c1-2-3-4-18-5-7-19(8-6-18)20-9-12-23(25(32)15-20)21-10-13-24(26(33)16-21)30(37,38)41-22-11-14-28(27(34)17-22)42-31(39,40)29(35)36/h2,5-17,29H,1,3-4H2 |
| InChIKey | YSJJCHNYMJZFJI-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.49 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|