C17H24N2O7 — CID 126627379
(2S,4S)-4-formamido-2-methyl-5-oxo-5-[(3,4,5-trimethoxyphenyl)methylamino]pentanoic acid (PubChem CID 126627379) has the molecular formula C17H24N2O7 and a molecular weight of 368.39 g/mol. Its IUPAC name is (2S,4S)-4-formamido-2-methyl-5-oxo-5-[(3,4,5-trimethoxyphenyl)methylamino]pentanoic acid.
| Compound Name | (2S,4S)-4-formamido-2-methyl-5-oxo-5-[(3,4,5-trimethoxyphenyl)methylamino]pentanoic acid |
|---|---|
| PubChem CID | 126627379 |
| Molecular Formula | C17H24N2O7 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (2S,4S)-4-formamido-2-methyl-5-oxo-5-[(3,4,5-trimethoxyphenyl)methylamino]pentanoic acid |
| SMILES | COc1cc(CNC(=O)[C@H](C[C@H](C)C(=O)O)NC=O)cc(OC)c1OC |
| InChI | InChI=1S/C17H24N2O7/c1-10(17(22)23)5-12(19-9-20)16(21)18-8-11-6-13(24-2)15(26-4)14(7-11)25-3/h6-7,9-10,12H,5,8H2,1-4H3,(H,18,21)(H,19,20)(H,22,23)/t10-,12-/m0/s1 |
| InChIKey | AAGKZKVSKYRPGR-JQWIXIFHSA-N |
| XLogP | 0.55 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|