C54H38N2 — CID 126628010
2,3,4,5,6-pentadeuterio-N-[4-[2-[9-(3,5-diphenylphenyl)carbazol-2-yl]phenyl]phenyl]-N-phenylaniline (PubChem CID 126628010) has the molecular formula C54H38N2 and a molecular weight of 719.94 g/mol. Its IUPAC name is 2,3,4,5,6-pentadeuterio-N-[4-[2-[9-(3,5-diphenylphenyl)carbazol-2-yl]phenyl]phenyl]-N-phenylaniline.
| Compound Name | 2,3,4,5,6-pentadeuterio-N-[4-[2-[9-(3,5-diphenylphenyl)carbazol-2-yl]phenyl]phenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 126628010 |
| Molecular Formula | C54H38N2 |
| Molecular Weight | 719.94 g/mol |
| Exact Mass | 719.33 |
| IUPAC Name | 2,3,4,5,6-pentadeuterio-N-[4-[2-[9-(3,5-diphenylphenyl)carbazol-2-yl]phenyl]phenyl]-N-phenylaniline |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2ccccc2)c2ccc(-c3ccccc3-c3ccc4c5ccccc5n(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)c4c3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C54H38N2/c1-5-17-39(18-6-1)43-35-44(40-19-7-2-8-20-40)37-48(36-43)56-53-28-16-15-27-51(53)52-34-31-42(38-54(52)56)50-26-14-13-25-49(50)41-29-32-47(33-30-41)55(45-21-9-3-10-22-45)46-23-11-4-12-24-46/h1-38H/i3D,9D,10D,21D,22D |
| InChIKey | FOLSAUQSNZRRAU-FDXMDVONSA-N |
| XLogP | 14.92 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.94 |
| LogP ≤ 5 | 14.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |