C48H32N2 — CID 140910752
N-(2,3,4,5,6-pentadeuteriophenyl)-9-(4-phenylphenyl)-N-triphenylen-2-ylcarbazol-2-amine (PubChem CID 140910752) has the molecular formula C48H32N2 and a molecular weight of 641.83 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentadeuteriophenyl)-9-(4-phenylphenyl)-N-triphenylen-2-ylcarbazol-2-amine.
| Compound Name | N-(2,3,4,5,6-pentadeuteriophenyl)-9-(4-phenylphenyl)-N-triphenylen-2-ylcarbazol-2-amine |
|---|---|
| PubChem CID | 140910752 |
| Molecular Formula | C48H32N2 |
| Molecular Weight | 641.83 g/mol |
| Exact Mass | 641.29 |
| IUPAC Name | N-(2,3,4,5,6-pentadeuteriophenyl)-9-(4-phenylphenyl)-N-triphenylen-2-ylcarbazol-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2ccc3c4ccccc4c4ccccc4c3c2)c2ccc3c4ccccc4n(-c4ccc(-c5ccccc5)cc4)c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C48H32N2/c1-3-13-33(14-4-1)34-23-25-36(26-24-34)50-47-22-12-11-21-44(47)45-30-28-38(32-48(45)50)49(35-15-5-2-6-16-35)37-27-29-43-41-19-8-7-17-39(41)40-18-9-10-20-42(40)46(43)31-37/h1-32H/i2D,5D,6D,15D,16D |
| InChIKey | QFRJZJANKFVJRE-KLZHWEBPSA-N |
| XLogP | 13.38 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.83 |
| LogP ≤ 5 | 13.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|