C19H29N3O8 — CID 126628262
tert-butyl 2-[[1-[(4R,6R,6aS)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2,4-dioxopyrimidin-5-yl]methylamino]acetate (PubChem CID 126628262) has the molecular formula C19H29N3O8 and a molecular weight of 427.45 g/mol. Its IUPAC name is tert-butyl 2-[[1-[(4R,6R,6aS)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2,4-dioxopyrimidin-5-yl]methylamino]acetate.
| Compound Name | tert-butyl 2-[[1-[(4R,6R,6aS)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2,4-dioxopyrimidin-5-yl]methylamino]acetate |
|---|---|
| PubChem CID | 126628262 |
| Molecular Formula | C19H29N3O8 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | tert-butyl 2-[[1-[(4R,6R,6aS)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2,4-dioxopyrimidin-5-yl]methylamino]acetate |
| SMILES | CC(C)(C)OC(=O)CNCc1cn([C@@H]2O[C@H](CO)[C@@H]3OC(C)(C)OC32)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H29N3O8/c1-18(2,3)28-12(24)7-20-6-10-8-22(17(26)21-15(10)25)16-14-13(11(9-23)27-16)29-19(4,5)30-14/h8,11,13-14,16,20,23H,6-7,9H2,1-5H3,(H,21,25,26)/t11-,13+,14?,16-/m1/s1 |
| InChIKey | UKYOGMDYBKITDD-MQMUZWCOSA-N |
| XLogP | -0.62 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |