C26H33N3O3S — CID 126628625
1'-butanoyl-2-(2-methoxyethylsulfanyl)-3-prop-2-enylspiro[6H-benzo[h]quinazoline-5,4'-piperidine]-4-one (PubChem CID 126628625) has the molecular formula C26H33N3O3S and a molecular weight of 467.64 g/mol. Its IUPAC name is 1'-butanoyl-2-(2-methoxyethylsulfanyl)-3-prop-2-enylspiro[6H-benzo[h]quinazoline-5,4'-piperidine]-4-one.
| Compound Name | 1'-butanoyl-2-(2-methoxyethylsulfanyl)-3-prop-2-enylspiro[6H-benzo[h]quinazoline-5,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 126628625 |
| Molecular Formula | C26H33N3O3S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 1'-butanoyl-2-(2-methoxyethylsulfanyl)-3-prop-2-enylspiro[6H-benzo[h]quinazoline-5,4'-piperidine]-4-one |
| SMILES | C=CCn1c(SCCOC)nc2c(c1=O)C1(CCN(C(=O)CCC)CC1)Cc1ccccc1-2 |
| InChI | InChI=1S/C26H33N3O3S/c1-4-8-21(30)28-14-11-26(12-15-28)18-19-9-6-7-10-20(19)23-22(26)24(31)29(13-5-2)25(27-23)33-17-16-32-3/h5-7,9-10H,2,4,8,11-18H2,1,3H3 |
| InChIKey | CUZPFMKAZXSAPA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|