C29H29N3O4S — CID 90011379
2-[2-[(2-ethylsulfanyl-5,5-dimethyl-4-oxo-3-prop-2-enyl-6H-benzo[h]quinazolin-8-yl)oxy]ethyl]isoindole-1,3-dione (PubChem CID 90011379) has the molecular formula C29H29N3O4S and a molecular weight of 515.64 g/mol. Its IUPAC name is 2-[2-[(2-ethylsulfanyl-5,5-dimethyl-4-oxo-3-prop-2-enyl-6H-benzo[h]quinazolin-8-yl)oxy]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(2-ethylsulfanyl-5,5-dimethyl-4-oxo-3-prop-2-enyl-6H-benzo[h]quinazolin-8-yl)oxy]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 90011379 |
| Molecular Formula | C29H29N3O4S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 2-[2-[(2-ethylsulfanyl-5,5-dimethyl-4-oxo-3-prop-2-enyl-6H-benzo[h]quinazolin-8-yl)oxy]ethyl]isoindole-1,3-dione |
| SMILES | C=CCn1c(SCC)nc2c(c1=O)C(C)(C)Cc1cc(OCCN3C(=O)c4ccccc4C3=O)ccc1-2 |
| InChI | InChI=1S/C29H29N3O4S/c1-5-13-32-27(35)23-24(30-28(32)37-6-2)20-12-11-19(16-18(20)17-29(23,3)4)36-15-14-31-25(33)21-9-7-8-10-22(21)26(31)34/h5,7-12,16H,1,6,13-15,17H2,2-4H3 |
| InChIKey | IPEZCEQCEFUGEL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|