C21H24N4OS — CID 45133252
9,9-dimethyl-13-propan-2-ylsulfanyl-15-prop-2-enyl-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaen-11-one (PubChem CID 45133252) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is 9,9-dimethyl-13-propan-2-ylsulfanyl-15-prop-2-enyl-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaen-11-one.
| Compound Name | 9,9-dimethyl-13-propan-2-ylsulfanyl-15-prop-2-enyl-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaen-11-one |
|---|---|
| PubChem CID | 45133252 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 9,9-dimethyl-13-propan-2-ylsulfanyl-15-prop-2-enyl-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaen-11-one |
| SMILES | C=CCn1nc(SC(C)C)n2c(=O)c3c(nc12)-c1ccccc1CC3(C)C |
| InChI | InChI=1S/C21H24N4OS/c1-6-11-24-19-22-17-15-10-8-7-9-14(15)12-21(4,5)16(17)18(26)25(19)20(23-24)27-13(2)3/h6-10,13H,1,11-12H2,2-5H3 |
| InChIKey | TWKVTDOOQYUQJZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|