C23H28N4OS — CID 51551192
(9S)-9-ethyl-9-methyl-15-(2-methylpropyl)-13-prop-2-enylsulfanyl-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaen-11-one (PubChem CID 51551192) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is (9S)-9-ethyl-9-methyl-15-(2-methylpropyl)-13-prop-2-enylsulfanyl-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaen-11-one.
| Compound Name | (9S)-9-ethyl-9-methyl-15-(2-methylpropyl)-13-prop-2-enylsulfanyl-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaen-11-one |
|---|---|
| PubChem CID | 51551192 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (9S)-9-ethyl-9-methyl-15-(2-methylpropyl)-13-prop-2-enylsulfanyl-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaen-11-one |
| SMILES | C=CCSc1nn(CC(C)C)c2nc3c(c(=O)n12)[C@@](C)(CC)Cc1ccccc1-3 |
| InChI | InChI=1S/C23H28N4OS/c1-6-12-29-22-25-26(14-15(3)4)21-24-19-17-11-9-8-10-16(17)13-23(5,7-2)18(19)20(28)27(21)22/h6,8-11,15H,1,7,12-14H2,2-5H3/t23-/m0/s1 |
| InChIKey | MMGKLBGDMBLQRW-QHCPKHFHSA-N |
| XLogP | 4.72 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|