C21H26N4OS — CID 51551128
(9R)-13-butylsulfanyl-9-ethyl-9,15-dimethyl-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaen-11-one (PubChem CID 51551128) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is (9R)-13-butylsulfanyl-9-ethyl-9,15-dimethyl-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaen-11-one.
| Compound Name | (9R)-13-butylsulfanyl-9-ethyl-9,15-dimethyl-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaen-11-one |
|---|---|
| PubChem CID | 51551128 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (9R)-13-butylsulfanyl-9-ethyl-9,15-dimethyl-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaen-11-one |
| SMILES | CCCCSc1nn(C)c2nc3c(c(=O)n12)[C@](C)(CC)Cc1ccccc1-3 |
| InChI | InChI=1S/C21H26N4OS/c1-5-7-12-27-20-23-24(4)19-22-17-15-11-9-8-10-14(15)13-21(3,6-2)16(17)18(26)25(19)20/h8-11H,5-7,12-13H2,1-4H3/t21-/m1/s1 |
| InChIKey | GMKDSDDMXUPFBZ-OAQYLSRUSA-N |
| XLogP | 4.21 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|