C27H32N2OS — CID 4313775
5-ethyl-2-hexylsulfanyl-5-methyl-3-phenyl-6H-benzo[h]quinazolin-4-one (PubChem CID 4313775) has the molecular formula C27H32N2OS and a molecular weight of 432.63 g/mol. Its IUPAC name is 5-ethyl-2-hexylsulfanyl-5-methyl-3-phenyl-6H-benzo[h]quinazolin-4-one.
| Compound Name | 5-ethyl-2-hexylsulfanyl-5-methyl-3-phenyl-6H-benzo[h]quinazolin-4-one |
|---|---|
| PubChem CID | 4313775 |
| Molecular Formula | C27H32N2OS |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 5-ethyl-2-hexylsulfanyl-5-methyl-3-phenyl-6H-benzo[h]quinazolin-4-one |
| SMILES | CCCCCCSc1nc2c(c(=O)n1-c1ccccc1)C(C)(CC)Cc1ccccc1-2 |
| InChI | InChI=1S/C27H32N2OS/c1-4-6-7-13-18-31-26-28-24-22-17-12-11-14-20(22)19-27(3,5-2)23(24)25(30)29(26)21-15-9-8-10-16-21/h8-12,14-17H,4-7,13,18-19H2,1-3H3 |
| InChIKey | KNPFGFHJBVFRNV-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|