C28H34N2OS — CID 4067557
5-ethyl-5-methyl-2-pentylsulfanyl-3-(2-phenylethyl)-6H-benzo[h]quinazolin-4-one (PubChem CID 4067557) has the molecular formula C28H34N2OS and a molecular weight of 446.66 g/mol. Its IUPAC name is 5-ethyl-5-methyl-2-pentylsulfanyl-3-(2-phenylethyl)-6H-benzo[h]quinazolin-4-one.
| Compound Name | 5-ethyl-5-methyl-2-pentylsulfanyl-3-(2-phenylethyl)-6H-benzo[h]quinazolin-4-one |
|---|---|
| PubChem CID | 4067557 |
| Molecular Formula | C28H34N2OS |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 5-ethyl-5-methyl-2-pentylsulfanyl-3-(2-phenylethyl)-6H-benzo[h]quinazolin-4-one |
| SMILES | CCCCCSc1nc2c(c(=O)n1CCc1ccccc1)C(C)(CC)Cc1ccccc1-2 |
| InChI | InChI=1S/C28H34N2OS/c1-4-6-12-19-32-27-29-25-23-16-11-10-15-22(23)20-28(3,5-2)24(25)26(31)30(27)18-17-21-13-8-7-9-14-21/h7-11,13-16H,4-6,12,17-20H2,1-3H3 |
| InChIKey | WNBYJUYNDCVARO-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|