C23H26N4O — CID 7509543
(5R)-5-ethyl-2-hydrazinyl-5-methyl-3-(2-phenylethyl)-6H-benzo[h]quinazolin-4-one (PubChem CID 7509543) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is (5R)-5-ethyl-2-hydrazinyl-5-methyl-3-(2-phenylethyl)-6H-benzo[h]quinazolin-4-one.
| Compound Name | (5R)-5-ethyl-2-hydrazinyl-5-methyl-3-(2-phenylethyl)-6H-benzo[h]quinazolin-4-one |
|---|---|
| PubChem CID | 7509543 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (5R)-5-ethyl-2-hydrazinyl-5-methyl-3-(2-phenylethyl)-6H-benzo[h]quinazolin-4-one |
| SMILES | CC[C@]1(C)Cc2ccccc2-c2nc(NN)n(CCc3ccccc3)c(=O)c21 |
| InChI | InChI=1S/C23H26N4O/c1-3-23(2)15-17-11-7-8-12-18(17)20-19(23)21(28)27(22(25-20)26-24)14-13-16-9-5-4-6-10-16/h4-12H,3,13-15,24H2,1-2H3,(H,25,26)/t23-/m1/s1 |
| InChIKey | XFCUFKXBYCLIKL-HSZRJFAPSA-N |
| XLogP | 3.66 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|