C31H31N5O — CID 6180742
3-(2-phenylethyl)-2-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one (PubChem CID 6180742) has the molecular formula C31H31N5O and a molecular weight of 489.62 g/mol. Its IUPAC name is 3-(2-phenylethyl)-2-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one.
| Compound Name | 3-(2-phenylethyl)-2-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 6180742 |
| Molecular Formula | C31H31N5O |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 3-(2-phenylethyl)-2-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one |
| SMILES | O=c1c2c(nc(N/N=C\c3ccncc3)n1CCc1ccccc1)-c1ccccc1CC21CCCCC1 |
| InChI | InChI=1S/C31H31N5O/c37-29-27-28(26-12-6-5-11-25(26)21-31(27)16-7-2-8-17-31)34-30(35-33-22-24-13-18-32-19-14-24)36(29)20-15-23-9-3-1-4-10-23/h1,3-6,9-14,18-19,22H,2,7-8,15-17,20-21H2,(H,34,35)/b33-22- |
| InChIKey | XLXQXODZRISWRQ-NVMPUMLXSA-N |
| XLogP | 5.75 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|