C18H20N2OS — CID 2904852
9-ethyl-9-methyl-16-thia-12,18-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,17-pentaen-11-one (PubChem CID 2904852) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is 9-ethyl-9-methyl-16-thia-12,18-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,17-pentaen-11-one.
| Compound Name | 9-ethyl-9-methyl-16-thia-12,18-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,17-pentaen-11-one |
|---|---|
| PubChem CID | 2904852 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 9-ethyl-9-methyl-16-thia-12,18-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,17-pentaen-11-one |
| SMILES | CCC1(C)Cc2ccccc2-c2nc3n(c(=O)c21)CCCS3 |
| InChI | InChI=1S/C18H20N2OS/c1-3-18(2)11-12-7-4-5-8-13(12)15-14(18)16(21)20-9-6-10-22-17(20)19-15/h4-5,7-8H,3,6,9-11H2,1-2H3 |
| InChIKey | UADQASVQSHCCOG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |