C28H34N2OS — CID 3850798
5-ethyl-5-methyl-2-(3-methylbutylsulfanyl)-3-(2-phenylethyl)-6H-benzo[h]quinazolin-4-one (PubChem CID 3850798) has the molecular formula C28H34N2OS and a molecular weight of 446.66 g/mol. Its IUPAC name is 5-ethyl-5-methyl-2-(3-methylbutylsulfanyl)-3-(2-phenylethyl)-6H-benzo[h]quinazolin-4-one.
| Compound Name | 5-ethyl-5-methyl-2-(3-methylbutylsulfanyl)-3-(2-phenylethyl)-6H-benzo[h]quinazolin-4-one |
|---|---|
| PubChem CID | 3850798 |
| Molecular Formula | C28H34N2OS |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 5-ethyl-5-methyl-2-(3-methylbutylsulfanyl)-3-(2-phenylethyl)-6H-benzo[h]quinazolin-4-one |
| SMILES | CCC1(C)Cc2ccccc2-c2nc(SCCC(C)C)n(CCc3ccccc3)c(=O)c21 |
| InChI | InChI=1S/C28H34N2OS/c1-5-28(4)19-22-13-9-10-14-23(22)25-24(28)26(31)30(17-15-21-11-7-6-8-12-21)27(29-25)32-18-16-20(2)3/h6-14,20H,5,15-19H2,1-4H3 |
| InChIKey | ZLJRUXPGTDLMAP-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |