C16H17F2N3OS2 — CID 126635055
N-[4-(1,1-difluoro-2-methylprop-2-enyl)-2-pyridin-3-yl-1,3-thiazol-5-yl]-3-methylsulfanylpropanamide (PubChem CID 126635055) has the molecular formula C16H17F2N3OS2 and a molecular weight of 369.46 g/mol. Its IUPAC name is N-[4-(1,1-difluoro-2-methylprop-2-enyl)-2-pyridin-3-yl-1,3-thiazol-5-yl]-3-methylsulfanylpropanamide.
| Compound Name | N-[4-(1,1-difluoro-2-methylprop-2-enyl)-2-pyridin-3-yl-1,3-thiazol-5-yl]-3-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 126635055 |
| Molecular Formula | C16H17F2N3OS2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | N-[4-(1,1-difluoro-2-methylprop-2-enyl)-2-pyridin-3-yl-1,3-thiazol-5-yl]-3-methylsulfanylpropanamide |
| SMILES | C=C(C)C(F)(F)c1nc(-c2cccnc2)sc1NC(=O)CCSC |
| InChI | InChI=1S/C16H17F2N3OS2/c1-10(2)16(17,18)13-15(20-12(22)6-8-23-3)24-14(21-13)11-5-4-7-19-9-11/h4-5,7,9H,1,6,8H2,2-3H3,(H,20,22) |
| InChIKey | CZEMMRPVXZJWTL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|