C20H15F5N2O4 — CID 126636559
2-(2,6-difluorophenoxy)-N-[(1Z,3E)-1-(methylamino)-5-oxopenta-1,3-dien-3-yl]-5-(trifluoromethoxy)benzamide (PubChem CID 126636559) has the molecular formula C20H15F5N2O4 and a molecular weight of 442.34 g/mol. Its IUPAC name is 2-(2,6-difluorophenoxy)-N-[(1Z,3E)-1-(methylamino)-5-oxopenta-1,3-dien-3-yl]-5-(trifluoromethoxy)benzamide.
| Compound Name | 2-(2,6-difluorophenoxy)-N-[(1Z,3E)-1-(methylamino)-5-oxopenta-1,3-dien-3-yl]-5-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 126636559 |
| Molecular Formula | C20H15F5N2O4 |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 2-(2,6-difluorophenoxy)-N-[(1Z,3E)-1-(methylamino)-5-oxopenta-1,3-dien-3-yl]-5-(trifluoromethoxy)benzamide |
| SMILES | CN/C=C\C(=C/C=O)NC(=O)c1cc(OC(F)(F)F)ccc1Oc1c(F)cccc1F |
| InChI | InChI=1S/C20H15F5N2O4/c1-26-9-7-12(8-10-28)27-19(29)14-11-13(31-20(23,24)25)5-6-17(14)30-18-15(21)3-2-4-16(18)22/h2-11,26H,1H3,(H,27,29)/b9-7-,12-8+ |
| InChIKey | OJUGAXDKKPCLLM-ZUQSVMQASA-N |
| XLogP | 4.20 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|