C21H22N2O3S — CID 126636851
N-(1-ethyl-8-ethynyl-2-oxo-3,4-dihydroquinolin-6-yl)-1-(4-methylphenyl)methanesulfonamide (PubChem CID 126636851) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-(1-ethyl-8-ethynyl-2-oxo-3,4-dihydroquinolin-6-yl)-1-(4-methylphenyl)methanesulfonamide.
| Compound Name | N-(1-ethyl-8-ethynyl-2-oxo-3,4-dihydroquinolin-6-yl)-1-(4-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 126636851 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | N-(1-ethyl-8-ethynyl-2-oxo-3,4-dihydroquinolin-6-yl)-1-(4-methylphenyl)methanesulfonamide |
| SMILES | C#Cc1cc(NS(=O)(=O)Cc2ccc(C)cc2)cc2c1N(CC)C(=O)CC2 |
| InChI | InChI=1S/C21H22N2O3S/c1-4-17-12-19(13-18-10-11-20(24)23(5-2)21(17)18)22-27(25,26)14-16-8-6-15(3)7-9-16/h1,6-9,12-13,22H,5,10-11,14H2,2-3H3 |
| InChIKey | FWHMLKUNCWYUAC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|