C22H24N2O3S — CID 126636852
N-(8-ethynyl-2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)-1-(4-methylphenyl)methanesulfonamide (PubChem CID 126636852) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is N-(8-ethynyl-2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)-1-(4-methylphenyl)methanesulfonamide.
| Compound Name | N-(8-ethynyl-2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)-1-(4-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 126636852 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-(8-ethynyl-2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)-1-(4-methylphenyl)methanesulfonamide |
| SMILES | C#Cc1cc(NS(=O)(=O)Cc2ccc(C)cc2)cc2c1N(CCC)C(=O)CC2 |
| InChI | InChI=1S/C22H24N2O3S/c1-4-12-24-21(25)11-10-19-14-20(13-18(5-2)22(19)24)23-28(26,27)15-17-8-6-16(3)7-9-17/h2,6-9,13-14,23H,4,10-12,15H2,1,3H3 |
| InChIKey | PWIQKKLSYNPTBH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|