C18H19FN4O6 — CID 126639307
1-[[(3S,4S)-3-ethyl-4-fluoro-5-oxopyrrolidin-2-yl]methoxy]-7-methoxy-4-nitroisoquinoline-6-carboxamide (PubChem CID 126639307) has the molecular formula C18H19FN4O6 and a molecular weight of 406.37 g/mol. Its IUPAC name is 1-[[(3S,4S)-3-ethyl-4-fluoro-5-oxopyrrolidin-2-yl]methoxy]-7-methoxy-4-nitroisoquinoline-6-carboxamide.
| Compound Name | 1-[[(3S,4S)-3-ethyl-4-fluoro-5-oxopyrrolidin-2-yl]methoxy]-7-methoxy-4-nitroisoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 126639307 |
| Molecular Formula | C18H19FN4O6 |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 1-[[(3S,4S)-3-ethyl-4-fluoro-5-oxopyrrolidin-2-yl]methoxy]-7-methoxy-4-nitroisoquinoline-6-carboxamide |
| SMILES | CC[C@H]1C(COc2ncc([N+](=O)[O-])c3cc(C(N)=O)c(OC)cc23)NC(=O)[C@H]1F |
| InChI | InChI=1S/C18H19FN4O6/c1-3-8-12(22-17(25)15(8)19)7-29-18-10-5-14(28-2)11(16(20)24)4-9(10)13(6-21-18)23(26)27/h4-6,8,12,15H,3,7H2,1-2H3,(H2,20,24)(H,22,25)/t8-,12?,15-/m0/s1 |
| InChIKey | QNYNMELLWJOQOF-IGZXRFPBSA-N |
| XLogP | 1.49 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|