C18H17FN4O5 — CID 126639719
1-[[(3S,4S)-3-ethyl-4-fluoro-5-oxopyrrolidin-2-yl]methoxy]-7-methoxy-4-nitroisoquinoline-6-carbonitrile (PubChem CID 126639719) has the molecular formula C18H17FN4O5 and a molecular weight of 388.36 g/mol. Its IUPAC name is 1-[[(3S,4S)-3-ethyl-4-fluoro-5-oxopyrrolidin-2-yl]methoxy]-7-methoxy-4-nitroisoquinoline-6-carbonitrile.
| Compound Name | 1-[[(3S,4S)-3-ethyl-4-fluoro-5-oxopyrrolidin-2-yl]methoxy]-7-methoxy-4-nitroisoquinoline-6-carbonitrile |
|---|---|
| PubChem CID | 126639719 |
| Molecular Formula | C18H17FN4O5 |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-[[(3S,4S)-3-ethyl-4-fluoro-5-oxopyrrolidin-2-yl]methoxy]-7-methoxy-4-nitroisoquinoline-6-carbonitrile |
| SMILES | CC[C@H]1C(COc2ncc([N+](=O)[O-])c3cc(C#N)c(OC)cc23)NC(=O)[C@H]1F |
| InChI | InChI=1S/C18H17FN4O5/c1-3-10-13(22-17(24)16(10)19)8-28-18-12-5-15(27-2)9(6-20)4-11(12)14(7-21-18)23(25)26/h4-5,7,10,13,16H,3,8H2,1-2H3,(H,22,24)/t10-,13?,16-/m0/s1 |
| InChIKey | LWACSVIJJXHFDX-HZUTZYCKSA-N |
| XLogP | 2.26 |
| TPSA | 127.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|