C24H20FN5O3 — CID 164787217
(3S,4S,5S)-4-ethyl-3-fluoro-5-[[6-isocyano-7-methoxy-4-(2-pyrimidin-5-ylethynyl)isoquinolin-1-yl]oxymethyl]pyrrolidin-2-one (PubChem CID 164787217) has the molecular formula C24H20FN5O3 and a molecular weight of 445.45 g/mol. Its IUPAC name is (3S,4S,5S)-4-ethyl-3-fluoro-5-[[6-isocyano-7-methoxy-4-(2-pyrimidin-5-ylethynyl)isoquinolin-1-yl]oxymethyl]pyrrolidin-2-one.
| Compound Name | (3S,4S,5S)-4-ethyl-3-fluoro-5-[[6-isocyano-7-methoxy-4-(2-pyrimidin-5-ylethynyl)isoquinolin-1-yl]oxymethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 164787217 |
| Molecular Formula | C24H20FN5O3 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | (3S,4S,5S)-4-ethyl-3-fluoro-5-[[6-isocyano-7-methoxy-4-(2-pyrimidin-5-ylethynyl)isoquinolin-1-yl]oxymethyl]pyrrolidin-2-one |
| SMILES | [C-]#[N+]c1cc2c(C#Cc3cncnc3)cnc(OC[C@H]3NC(=O)[C@@H](F)[C@H]3CC)c2cc1OC |
| InChI | InChI=1S/C24H20FN5O3/c1-4-16-20(30-23(31)22(16)25)12-33-24-18-8-21(32-3)19(26-2)7-17(18)15(11-29-24)6-5-14-9-27-13-28-10-14/h7-11,13,16,20,22H,4,12H2,1,3H3,(H,30,31)/t16-,20+,22-/m0/s1 |
| InChIKey | OMYFXOUKTJXFQB-AQKFKSFVSA-N |
| XLogP | 3.23 |
| TPSA | 90.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|