C25H21FN4O3 — CID 164787200
(3S,4S,5S)-4-ethyl-3-fluoro-5-[[6-isocyano-7-methoxy-4-(2-pyridin-3-ylethynyl)isoquinolin-1-yl]oxymethyl]pyrrolidin-2-one (PubChem CID 164787200) has the molecular formula C25H21FN4O3 and a molecular weight of 444.47 g/mol. Its IUPAC name is (3S,4S,5S)-4-ethyl-3-fluoro-5-[[6-isocyano-7-methoxy-4-(2-pyridin-3-ylethynyl)isoquinolin-1-yl]oxymethyl]pyrrolidin-2-one.
| Compound Name | (3S,4S,5S)-4-ethyl-3-fluoro-5-[[6-isocyano-7-methoxy-4-(2-pyridin-3-ylethynyl)isoquinolin-1-yl]oxymethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 164787200 |
| Molecular Formula | C25H21FN4O3 |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (3S,4S,5S)-4-ethyl-3-fluoro-5-[[6-isocyano-7-methoxy-4-(2-pyridin-3-ylethynyl)isoquinolin-1-yl]oxymethyl]pyrrolidin-2-one |
| SMILES | [C-]#[N+]c1cc2c(C#Cc3cccnc3)cnc(OC[C@H]3NC(=O)[C@@H](F)[C@H]3CC)c2cc1OC |
| InChI | InChI=1S/C25H21FN4O3/c1-4-17-21(30-24(31)23(17)26)14-33-25-19-11-22(32-3)20(27-2)10-18(19)16(13-29-25)8-7-15-6-5-9-28-12-15/h5-6,9-13,17,21,23H,4,14H2,1,3H3,(H,30,31)/t17-,21+,23-/m0/s1 |
| InChIKey | LQNIGQUEGFMPBW-LXBDKUERSA-N |
| XLogP | 3.83 |
| TPSA | 77.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|