C14H16N2O4 — CID 126639616
1-methoxy-7-(2-methoxyethoxy)isoquinoline-6-carboxamide (PubChem CID 126639616) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 1-methoxy-7-(2-methoxyethoxy)isoquinoline-6-carboxamide.
| Compound Name | 1-methoxy-7-(2-methoxyethoxy)isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 126639616 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-methoxy-7-(2-methoxyethoxy)isoquinoline-6-carboxamide |
| SMILES | COCCOc1cc2c(OC)nccc2cc1C(N)=O |
| InChI | InChI=1S/C14H16N2O4/c1-18-5-6-20-12-8-10-9(7-11(12)13(15)17)3-4-16-14(10)19-2/h3-4,7-8H,5-6H2,1-2H3,(H2,15,17) |
| InChIKey | VVARRJHEBOUHGP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|