C29H24N2O7S — CID 126639829
4-[(10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl)oxysulfanyl]benzoic acid (PubChem CID 126639829) has the molecular formula C29H24N2O7S and a molecular weight of 544.59 g/mol. Its IUPAC name is 4-[(10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl)oxysulfanyl]benzoic acid.
| Compound Name | 4-[(10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl)oxysulfanyl]benzoic acid |
|---|---|
| PubChem CID | 126639829 |
| Molecular Formula | C29H24N2O7S |
| Molecular Weight | 544.59 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | 4-[(10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl)oxysulfanyl]benzoic acid |
| SMILES | CCc1c2c(nc3ccc(OSc4ccc(C(=O)O)cc4)cc13)-c1cc3c(c(=O)n1C2)COC(=O)C3(O)CC |
| InChI | InChI=1S/C29H24N2O7S/c1-3-18-19-11-16(38-39-17-8-5-15(6-9-17)27(33)34)7-10-23(19)30-25-20(18)13-31-24(25)12-22-21(26(31)32)14-37-28(35)29(22,36)4-2/h5-12,36H,3-4,13-14H2,1-2H3,(H,33,34) |
| InChIKey | FOIFEAQRYQGBAZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|