C28H47NO4 — CID 126641235
(6R)-6-[(3R,5R,8R,9S,10S,13R,14S)-3-(2-aminoacetyl)oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid (PubChem CID 126641235) has the molecular formula C28H47NO4 and a molecular weight of 461.69 g/mol. Its IUPAC name is (6R)-6-[(3R,5R,8R,9S,10S,13R,14S)-3-(2-aminoacetyl)oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid.
| Compound Name | (6R)-6-[(3R,5R,8R,9S,10S,13R,14S)-3-(2-aminoacetyl)oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid |
|---|---|
| PubChem CID | 126641235 |
| Molecular Formula | C28H47NO4 |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 461.35 |
| IUPAC Name | (6R)-6-[(3R,5R,8R,9S,10S,13R,14S)-3-(2-aminoacetyl)oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid |
| SMILES | C[C@H](CCCCC(=O)O)C1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](OC(=O)CN)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H47NO4/c1-18(6-4-5-7-25(30)31)22-10-11-23-21-9-8-19-16-20(33-26(32)17-29)12-14-27(19,2)24(21)13-15-28(22,23)3/h18-24H,4-17,29H2,1-3H3,(H,30,31)/t18-,19-,20-,21+,22?,23+,24+,27+,28-/m1/s1 |
| InChIKey | ILEWVIGIESMMMH-LOIWFPJISA-N |
| XLogP | 5.80 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|